CAS 141215-32-9 appears in our catalog under these names: 4,7–Dibromobenzo(c)(1,2,5)thiadiazole–5,6–diamine, 4,7-dibromo-2,1,3-benzothiadiazole-5,6-diamine, 95%, 95%, 4,7-Dibromobenzo[c][1,2,5]thiadiazole-5,6-diamine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
4,7-dibromo-2,1,3-benzothiadiazole-5,6-diamine (CAS 141215-32-9) is a chemical compound with the molecular formula C6H4Br2N4S and a molecular weight of 324.00 g/mol. IUPAC name: 4,7-dibromo-2,1,3-benzothiadiazole-5,6-diamine. InChIKey: SFFHORYSGHXVGU-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N4S |
|---|---|
| Molecular weight | 324.00 g/mol |
| IUPAC name | 4,7-dibromo-2,1,3-benzothiadiazole-5,6-diamine |
| InChIKey | SFFHORYSGHXVGU-UHFFFAOYSA-N |
| SMILES | C1(=C(C2=NSN=C2C(=C1N)Br)Br)N |
Computed by PubChem (NCBI)