CAS 141238-22-4 appears in our catalog under these names: 3-Chloro-5-nitropicolinaldehyde, 90%, 3-Chloro-5-nitropicolinaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-chloro-5-nitropyridine-2-carbaldehyde (CAS 141238-22-4) is a chemical compound with the molecular formula C6H3ClN2O3 and a molecular weight of 186.55 g/mol. IUPAC name: 3-chloro-5-nitropyridine-2-carbaldehyde. InChIKey: JHZABTLKWJQLTR-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O3 |
|---|---|
| Molecular weight | 186.55 g/mol |
| IUPAC name | 3-chloro-5-nitropyridine-2-carbaldehyde |
| InChIKey | JHZABTLKWJQLTR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)