Products 1412411-11-0
CAS 1412411-11-0 appears in our catalog under these names: Monopropylheptylphthalate 6-Hydroxy-d4, >95% (HPLC), 1-(6-Hydroxy-2-propylheptyl) hydrogen 1,2-benzenedicarboxylate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,3,4,5-tetradeuterio-6-(6-hydroxy-2-propylheptoxy)carbonylbenzoic acid (CAS 1412411-11-0) is a chemical compound with the molecular formula C18H26O5 and a molecular weight of 326.4 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(6-hydroxy-2-propylheptoxy)carbonylbenzoic acid. InChIKey: KNDRVUYMYPIFIU-MHKQSWFVSA-N.
| Molecular formula | C18H26O5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(6-hydroxy-2-propylheptoxy)carbonylbenzoic acid |
| InChIKey | KNDRVUYMYPIFIU-MHKQSWFVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CCC)CCCC(C)O)[2H])[2H] |
Computed by PubChem (NCBI)