CAS 14126-40-0 appears in our catalog under these names: Dichlorobis(triphenylphosphine)cobalt(II), Bis(triphenylphosphine)cobalt dichloride 97%, DICHLOROBIS(TRIPHENYLPHOSPHINE)COBALT(I&, Bis(triphenylphosphine)cobalt dichloride, 97%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 25g, 500g, 1g, 5g.
Dichlorocobalt;bis(triphenylphosphane) (CAS 14126-40-0) is a chemical compound with the molecular formula C36H30Cl2CoP2 and a molecular weight of 654.4 g/mol. IUPAC name: dichlorocobalt;bis(triphenylphosphane). InChIKey: OPRPFIIIFJLFCE-UHFFFAOYSA-L.
| Molecular formula | C36H30Cl2CoP2 |
|---|---|
| Molecular weight | 654.4 g/mol |
| IUPAC name | dichlorocobalt;bis(triphenylphosphane) |
| InChIKey | OPRPFIIIFJLFCE-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Co]Cl |
Computed by PubChem (NCBI)