Products 141266-44-6
CAS 141266-44-6 is the registry number for EM20-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(7-chloro-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione (CAS 141266-44-6) is a chemical compound with the molecular formula C15H9ClN4O6 and a molecular weight of 376.71 g/mol. IUPAC name: 5-(7-chloro-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione. InChIKey: GGEVZGGAQHNWQN-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN4O6 |
|---|---|
| Molecular weight | 376.71 g/mol |
| IUPAC name | 5-(7-chloro-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione |
| InChIKey | GGEVZGGAQHNWQN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(C3=C(O2)NC(=O)NC3=O)C4C(=O)NC(=O)NC4=O |
Computed by PubChem (NCBI)
Synonyms:
Bcl-2 Inhibitor III, EM20-25, Bcl-2 Inhibitor III