CAS 14128-73-5 is the registry number for Bis(2-methyl-8-hydroxyquinolinato)zinc, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc bis(2-methylquinolin-8-olate) (CAS 14128-73-5) is a chemical compound with the molecular formula C20H16N2O2Zn and a molecular weight of 381.7 g/mol. IUPAC name: zinc bis(2-methylquinolin-8-olate). InChIKey: ZTPMNXZOPFKOIV-UHFFFAOYSA-L.
| Molecular formula | C20H16N2O2Zn |
|---|---|
| Molecular weight | 381.7 g/mol |
| IUPAC name | zinc bis(2-methylquinolin-8-olate) |
| InChIKey | ZTPMNXZOPFKOIV-UHFFFAOYSA-L |
| SMILES | CC1=NC2=C(C=CC=C2[O-])C=C1.CC1=NC2=C(C=CC=C2[O-])C=C1.[Zn+2] |
Computed by PubChem (NCBI)