CAS 141284-74-4 is the registry number for Fuzapladib (potassium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Potassium [3-(cyclohexanecarbonylamino)-5-(trifluoromethyl)-2-pyridinyl]-ethylsulfonylazanide (CAS 141284-74-4) is a chemical compound with the molecular formula C15H19F3KN3O3S and a molecular weight of 417.5 g/mol. IUPAC name: potassium [3-(cyclohexanecarbonylamino)-5-(trifluoromethyl)-2-pyridinyl]-ethylsulfonylazanide. InChIKey: RAZLFMFISMFZBG-UHFFFAOYSA-M.
| Molecular formula | C15H19F3KN3O3S |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | potassium [3-(cyclohexanecarbonylamino)-5-(trifluoromethyl)-2-pyridinyl]-ethylsulfonylazanide |
| InChIKey | RAZLFMFISMFZBG-UHFFFAOYSA-M |
| SMILES | CCS(=O)(=O)[N-]C1=C(C=C(C=N1)C(F)(F)F)NC(=O)C2CCCCC2.[K+] |
Computed by PubChem (NCBI)