CAS 1413063-73-6 is the registry number for 2-Bromo-6-(6-(tert-butyl)-8-fluoro-1-oxophthalazin-2(1H)-yl)benzyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-bromo-6-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)phenyl]methyl acetate (CAS 1413063-73-6) is a chemical compound with the molecular formula C21H20BrFN2O3 and a molecular weight of 447.3 g/mol. IUPAC name: [2-bromo-6-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)phenyl]methyl acetate. InChIKey: VENWSTOWCMTMON-UHFFFAOYSA-N.
| Molecular formula | C21H20BrFN2O3 |
|---|---|
| Molecular weight | 447.3 g/mol |
| IUPAC name | [2-bromo-6-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)phenyl]methyl acetate |
| InChIKey | VENWSTOWCMTMON-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC=C1Br)N2C(=O)C3=C(C=C(C=C3F)C(C)(C)C)C=N2 |
Computed by PubChem (NCBI)