CAS 14133-23-4 appears in our catalog under these names: 2-Mercapto-3-phenylpyrido[2,3-d]pyrimidin-4(3H)-one, 95+%, 3-Phenyl-2-sulfanylidene-1H,2H,3H,4H-pyrido(2,3-d)pyrimidin-4-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2,5g, 250mg.
3-phenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (CAS 14133-23-4) is a chemical compound with the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. IUPAC name: 3-phenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: ZWIFJDMIIROEBY-UHFFFAOYSA-N.
| Molecular formula | C13H9N3OS |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 3-phenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | ZWIFJDMIIROEBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(NC2=S)N=CC=C3 |
Computed by PubChem (NCBI)