Products 141335-11-7
CAS 141335-11-7 is the registry number for LCB 2853 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2-[4-[[1-[[(4-chlorophenyl)sulfonylamino]methyl]cyclopentyl]methyl]phenyl]acetate (CAS 141335-11-7) is a chemical compound with the molecular formula C21H23ClNNaO4S and a molecular weight of 443.9 g/mol. IUPAC name: sodium 2-[4-[[1-[[(4-chlorophenyl)sulfonylamino]methyl]cyclopentyl]methyl]phenyl]acetate. InChIKey: WVVUYAHTYLRPEB-UHFFFAOYSA-M.
| Molecular formula | C21H23ClNNaO4S |
|---|---|
| Molecular weight | 443.9 g/mol |
| IUPAC name | sodium 2-[4-[[1-[[(4-chlorophenyl)sulfonylamino]methyl]cyclopentyl]methyl]phenyl]acetate |
| InChIKey | WVVUYAHTYLRPEB-UHFFFAOYSA-M |
| SMILES | C1CCC(C1)(CC2=CC=C(C=C2)CC(=O)[O-])CNS(=O)(=O)C3=CC=C(C=C3)Cl.[Na+] |
Computed by PubChem (NCBI)