CAS 14134-81-7 appears in our catalog under these names: 1-Ethyl-2,3,3-trimethylindolenium Iodide, 1-Ethyl-2,3,3-trimethyl-3H-indolium Iodide, >98.0%(HPLC)(T), 1-Ethyl-2,3,3-trimethyl-3H-indol-1-ium iodide 97%, 1-Ethyl-2,3,3-trimethyl-3H-indolium Iodide, 97%, 97%, 1-Ethyl-2,3,3-trimethyl-3H-indol-1-ium iodide, 97%. Offered by: TRC, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 5g, 25g, 250mg, 1g, 100mg.
1-ethyl-2,3,3-trimethylindol-1-ium iodide (CAS 14134-81-7) is a chemical compound with the molecular formula C13H18IN and a molecular weight of 315.19 g/mol. IUPAC name: 1-ethyl-2,3,3-trimethylindol-1-ium iodide. InChIKey: WHXDRZOCHPMFIX-UHFFFAOYSA-M.
| Molecular formula | C13H18IN |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 1-ethyl-2,3,3-trimethylindol-1-ium iodide |
| InChIKey | WHXDRZOCHPMFIX-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(C(C2=CC=CC=C21)(C)C)C.[I-] |
Computed by PubChem (NCBI)