Products 1413433-77-8
CAS 1413433-77-8 appears in our catalog under these names: 4,4'-(2,3,6,7-Tetramethoxyanthracene-9,10-diyl)dibenzoic acid, 98%, 4,4′-(2,3,6,7-Tetramethoxy-9,10-anthracenediyl)bis[benzoic acid], 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 50mg.
4-[10-(4-carboxyphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzoic acid (CAS 1413433-77-8) is a chemical compound with the molecular formula C32H26O8 and a molecular weight of 538.5 g/mol. IUPAC name: 4-[10-(4-carboxyphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzoic acid. InChIKey: YHEQBZDDSXSVCU-UHFFFAOYSA-N.
| Molecular formula | C32H26O8 |
|---|---|
| Molecular weight | 538.5 g/mol |
| IUPAC name | 4-[10-(4-carboxyphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzoic acid |
| InChIKey | YHEQBZDDSXSVCU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C3=CC(=C(C=C3C(=C2C=C1OC)C4=CC=C(C=C4)C(=O)O)OC)OC)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)