Products 1413642-27-9
CAS 1413642-27-9 is the registry number for O-Acetyl Tramadol. Offered by: TRC. Available pack sizes: 2,5g.
[(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] acetate (CAS 1413642-27-9) is a chemical compound with the molecular formula C18H27NO3 and a molecular weight of 305.4 g/mol. IUPAC name: [(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] acetate. InChIKey: LQUPISJKOHCHAY-AEFFLSMTSA-N.
| Molecular formula | C18H27NO3 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | [(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] acetate |
| InChIKey | LQUPISJKOHCHAY-AEFFLSMTSA-N |
| SMILES | CC(=O)O[C@@]1(CCCC[C@@H]1CN(C)C)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)
Synonyms:
O-Acetyl Tramadol