CAS 141368-95-8 appears in our catalog under these names: (2E,4E)-1-(4-Chlorophenyl)-5-phenylpenta-2,4-dien-1-one, 95%, (2E,4E)-1-(4-Chlorophenyl)-5-phenylpenta-2,4-dien-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2g.
(2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-one (CAS 141368-95-8) is a chemical compound with the molecular formula C17H13ClO and a molecular weight of 268.7 g/mol. IUPAC name: (2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-one. InChIKey: NJZYARIVQCEJQT-KBXRYBNXSA-N.
| Molecular formula | C17H13ClO |
|---|---|
| Molecular weight | 268.7 g/mol |
| IUPAC name | (2E,4E)-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-one |
| InChIKey | NJZYARIVQCEJQT-KBXRYBNXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)