CAS 1413723-26-8 is the registry number for 1-((1R)-2-Iodo-1-methylethyl)-4-methylbenzene. Offered by: TRC. Available pack sizes: 500mg.
1-[(2R)-1-iodopropan-2-yl]-4-methylbenzene (CAS 1413723-26-8) is a chemical compound with the molecular formula C10H13I and a molecular weight of 260.11 g/mol. IUPAC name: 1-[(2R)-1-iodopropan-2-yl]-4-methylbenzene. InChIKey: GKMSNNRIWWJYTA-VIFPVBQESA-N.
| Molecular formula | C10H13I |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 1-[(2R)-1-iodopropan-2-yl]-4-methylbenzene |
| InChIKey | GKMSNNRIWWJYTA-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H](C)CI |
Computed by PubChem (NCBI)