CAS 141396-05-6 is the registry number for (S)-2-Hydroxypropyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-2-hydroxypropyl] benzoate (CAS 141396-05-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: [(2S)-2-hydroxypropyl] benzoate. InChIKey: SCYRDAWUOAHQIE-QMMMGPOBSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | [(2S)-2-hydroxypropyl] benzoate |
| InChIKey | SCYRDAWUOAHQIE-QMMMGPOBSA-N |
| SMILES | C[C@@H](COC(=O)C1=CC=CC=C1)O |
Computed by PubChem (NCBI)