Products 1414029-40-5
CAS 1414029-40-5 is the registry number for Methyl 2-amino-5-(4-formylphenyl)pyridine-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g.
Methyl 2-amino-5-(4-formylphenyl)pyridine-3-carboxylate (CAS 1414029-40-5) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: methyl 2-amino-5-(4-formylphenyl)pyridine-3-carboxylate. InChIKey: SPUZJSNKZVBSEY-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | methyl 2-amino-5-(4-formylphenyl)pyridine-3-carboxylate |
| InChIKey | SPUZJSNKZVBSEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)C2=CC=C(C=C2)C=O)N |
Computed by PubChem (NCBI)