CAS 14143-46-5 is the registry number for 4-Amino-3,5,6-trichloro-2-pyridinecarboxamide. Offered by: TRC. Available pack sizes: 100mg.
4-amino-3,5,6-trichloropyridine-2-carboxamide (CAS 14143-46-5) is a chemical compound with the molecular formula C6H4Cl3N3O and a molecular weight of 240.5 g/mol. IUPAC name: 4-amino-3,5,6-trichloropyridine-2-carboxamide. InChIKey: GLDXINQVIRUDHL-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3N3O |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 4-amino-3,5,6-trichloropyridine-2-carboxamide |
| InChIKey | GLDXINQVIRUDHL-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(=O)N)Cl)N |
Computed by PubChem (NCBI)