CAS 1414348-36-9 is the registry number for (2R)-2-(3,4-difluorophenyl)oxirane, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R)-2-(3,4-difluorophenyl)oxirane (CAS 1414348-36-9) is a chemical compound with the molecular formula C8H6F2O and a molecular weight of 156.13 g/mol. IUPAC name: (2R)-2-(3,4-difluorophenyl)oxirane. InChIKey: UNJRFWWCCAHSRB-QMMMGPOBSA-N.
| Molecular formula | C8H6F2O |
|---|---|
| Molecular weight | 156.13 g/mol |
| IUPAC name | (2R)-2-(3,4-difluorophenyl)oxirane |
| InChIKey | UNJRFWWCCAHSRB-QMMMGPOBSA-N |
| SMILES | C1[C@H](O1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)