CAS 1414521-33-7 is the registry number for N,N-Bis(2-bromophenyl)benzenemethanamine, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
N-benzyl-2-bromo-N-(2-bromophenyl)aniline (CAS 1414521-33-7) is a chemical compound with the molecular formula C19H15Br2N and a molecular weight of 417.1 g/mol. IUPAC name: N-benzyl-2-bromo-N-(2-bromophenyl)aniline. InChIKey: NOGBCJUMKFSRMC-UHFFFAOYSA-N.
| Molecular formula | C19H15Br2N |
|---|---|
| Molecular weight | 417.1 g/mol |
| IUPAC name | N-benzyl-2-bromo-N-(2-bromophenyl)aniline |
| InChIKey | NOGBCJUMKFSRMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2Br)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)