CAS 1414566-62-3 is the registry number for rel-(3S,4R)-1-(2-Methoxyethyl)-4-phenylpyrrolidin-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine;dihydrochloride (CAS 1414566-62-3) is a chemical compound with the molecular formula C13H22Cl2N2O and a molecular weight of 293.23 g/mol. IUPAC name: (3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine;dihydrochloride. InChIKey: PHRNRZZMLWTRDB-CQSOCPNPSA-N.
| Molecular formula | C13H22Cl2N2O |
|---|---|
| Molecular weight | 293.23 g/mol |
| IUPAC name | (3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | PHRNRZZMLWTRDB-CQSOCPNPSA-N |
| SMILES | COCCN1C[C@H]([C@@H](C1)N)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)