CAS 141458-80-2 appears in our catalog under these names: 3-Amino-5-tert-butyl-1h-pyrazole-4-carbonitrile, 95%, 3–Amino–5–(tert–butyl)–1H–pyrazole–4–carbonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-amino-5-tert-butyl-1H-pyrazole-4-carbonitrile (CAS 141458-80-2) is a chemical compound with the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. IUPAC name: 3-amino-5-tert-butyl-1H-pyrazole-4-carbonitrile. InChIKey: CYCIDKHJBSFNAY-UHFFFAOYSA-N.
| Molecular formula | C8H12N4 |
|---|---|
| Molecular weight | 164.21 g/mol |
| IUPAC name | 3-amino-5-tert-butyl-1H-pyrazole-4-carbonitrile |
| InChIKey | CYCIDKHJBSFNAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=NN1)N)C#N |
Computed by PubChem (NCBI)