CAS 1414870-80-6 appears in our catalog under these names: 1,3-Dichloro-2-iodo-5-(trifluoromethoxy)benzene, 95%, 1,3-Dichloro-2-iodo-5-(trifluoromethoxy)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
1,3-dichloro-2-iodo-5-(trifluoromethoxy)benzene (CAS 1414870-80-6) is a chemical compound with the molecular formula C7H2Cl2F3IO and a molecular weight of 356.89 g/mol. IUPAC name: 1,3-dichloro-2-iodo-5-(trifluoromethoxy)benzene. InChIKey: VXYKBILXCGGNTA-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3IO |
|---|---|
| Molecular weight | 356.89 g/mol |
| IUPAC name | 1,3-dichloro-2-iodo-5-(trifluoromethoxy)benzene |
| InChIKey | VXYKBILXCGGNTA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)I)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)