CAS 1414958-70-5 is the registry number for tert-Butyl (6-bromo-2,3-dihydro-1H-inden-1-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-(6-bromo-2,3-dihydro-1H-inden-1-yl)carbamate (CAS 1414958-70-5) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl N-(6-bromo-2,3-dihydro-1H-inden-1-yl)carbamate. InChIKey: YZEZLDIZHPBHGQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-2,3-dihydro-1H-inden-1-yl)carbamate |
| InChIKey | YZEZLDIZHPBHGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)