CAS 1414959-15-1 is the registry number for 2,3-Diaminofluorobenzene hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-fluorobenzene-1,2-diamine;dihydrochloride (CAS 1414959-15-1) is a chemical compound with the molecular formula C6H9Cl2FN2 and a molecular weight of 199.05 g/mol. IUPAC name: 3-fluorobenzene-1,2-diamine;dihydrochloride. InChIKey: XKPZVARNGDULED-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl2FN2 |
|---|---|
| Molecular weight | 199.05 g/mol |
| IUPAC name | 3-fluorobenzene-1,2-diamine;dihydrochloride |
| InChIKey | XKPZVARNGDULED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)