Products 1415050-57-5
CAS 1415050-57-5 is the registry number for ERK2-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-[2-(cyclopropylamino)quinazolin-6-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide (CAS 1415050-57-5) is a chemical compound with the molecular formula C26H21F3N4O and a molecular weight of 462.5 g/mol. IUPAC name: N-[3-[2-(cyclopropylamino)quinazolin-6-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide. InChIKey: BYBFDHQBBWQPTD-UHFFFAOYSA-N.
| Molecular formula | C26H21F3N4O |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | N-[3-[2-(cyclopropylamino)quinazolin-6-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| InChIKey | BYBFDHQBBWQPTD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(F)(F)F)C3=CC4=CN=C(N=C4C=C3)NC5CC5 |
Computed by PubChem (NCBI)
Synonyms:
4i5h, orb1703416