CAS 1415212-90-6 is the registry number for Perampanel Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-2-oxo-5-pyridin-2-yl-1-pyridinyl)benzonitrile (CAS 1415212-90-6) is a chemical compound with the molecular formula C17H10BrN3O and a molecular weight of 352.2 g/mol. IUPAC name: 2-(3-bromo-2-oxo-5-pyridin-2-yl-1-pyridinyl)benzonitrile. InChIKey: YOAMZRXUTZXZBO-UHFFFAOYSA-N.
| Molecular formula | C17H10BrN3O |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 2-(3-bromo-2-oxo-5-pyridin-2-yl-1-pyridinyl)benzonitrile |
| InChIKey | YOAMZRXUTZXZBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)N2C=C(C=C(C2=O)Br)C3=CC=CC=N3 |
Computed by PubChem (NCBI)