Products 141538-75-2

CAS 141538-75-2 is the registry number for (6E,10E)-7,11,15-Trimethyl-3-oxohexadeca-6,10,14-trienoic Acid, Ethyl Ester,(Mixture of Isomers). Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate (CAS 141538-75-2) is a chemical compound with the molecular formula C21H34O3 and a molecular weight of 334.5 g/mol. IUPAC name: ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate. InChIKey: JDITVCKWSUFDMU-IJNKXORISA-N.

Identity
Molecular formulaC21H34O3
Molecular weight334.5 g/mol
IUPAC nameethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate
InChIKeyJDITVCKWSUFDMU-IJNKXORISA-N
SMILESCCOC(=O)CC(=O)CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C

Computed by PubChem (NCBI)