CAS 141543-63-7 appears in our catalog under these names: 1-(5-Isoquinolinesulfonyl)piperazine Hydrochloride, >95% (HPLC), HA-100 hydrochloride, 1-(5-Isoquinolinesulfonyl)piperazine hydrochloride, HA-100 (hydrochloride). Offered by: TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 250mg, 25mg, 50mg, 5mg, 10mg, 100mg, Get quote.
5-piperazin-1-ylsulfonylisoquinoline;hydrochloride (CAS 141543-63-7) is a chemical compound with the molecular formula C13H16ClN3O2S and a molecular weight of 313.80 g/mol. IUPAC name: 5-piperazin-1-ylsulfonylisoquinoline;hydrochloride. InChIKey: MBZNIYPWRIDBOD-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O2S |
|---|---|
| Molecular weight | 313.80 g/mol |
| IUPAC name | 5-piperazin-1-ylsulfonylisoquinoline;hydrochloride |
| InChIKey | MBZNIYPWRIDBOD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3.Cl |
Computed by PubChem (NCBI)