Products 1415608-33-1

CAS 1415608-33-1 is the registry number for 2–Thia–6–azaspiro(3·3)heptane 2,2–dioxide hemioxalate. Offered by: GLPBio. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Bis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid (CAS 1415608-33-1) is a chemical compound with the molecular formula C12H20N2O8S2 and a molecular weight of 384.4 g/mol. IUPAC name: bis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid. InChIKey: RVNCDCMFQKKHEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O8S2
Molecular weight384.4 g/mol
IUPAC namebis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid
InChIKeyRVNCDCMFQKKHEZ-UHFFFAOYSA-N
SMILESC1C2(CN1)CS(=O)(=O)C2.C1C2(CN1)CS(=O)(=O)C2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)