CAS 1415608-33-1 is the registry number for 2–Thia–6–azaspiro(3·3)heptane 2,2–dioxide hemioxalate. Offered by: GLPBio. Available pack sizes: 250mg.
Bis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid (CAS 1415608-33-1) is a chemical compound with the molecular formula C12H20N2O8S2 and a molecular weight of 384.4 g/mol. IUPAC name: bis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid. InChIKey: RVNCDCMFQKKHEZ-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O8S2 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | bis(2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide);oxalic acid |
| InChIKey | RVNCDCMFQKKHEZ-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CS(=O)(=O)C2.C1C2(CN1)CS(=O)(=O)C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)