CAS 141579-67-1 is the registry number for A-78773. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-[5-(4-fluorophenoxy)furan-2-yl]but-3-yn-2-yl]-1-hydroxyurea (CAS 141579-67-1) is a chemical compound with the molecular formula C15H13FN2O4 and a molecular weight of 304.27 g/mol. IUPAC name: 1-[4-[5-(4-fluorophenoxy)furan-2-yl]but-3-yn-2-yl]-1-hydroxyurea. InChIKey: OLZHFFKRBCZHHT-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2O4 |
|---|---|
| Molecular weight | 304.27 g/mol |
| IUPAC name | 1-[4-[5-(4-fluorophenoxy)furan-2-yl]but-3-yn-2-yl]-1-hydroxyurea |
| InChIKey | OLZHFFKRBCZHHT-UHFFFAOYSA-N |
| SMILES | CC(C#CC1=CC=C(O1)OC2=CC=C(C=C2)F)N(C(=O)N)O |
Computed by PubChem (NCBI)