CAS 1415793-76-8 is the registry number for 1-(tert-Butyl) 3-methyl 5-((tert-butyldimethylsilyl)oxy)piperidine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl 5-[tert-butyl(dimethyl)silyl]oxypiperidine-1,3-dicarboxylate (CAS 1415793-76-8) is a chemical compound with the molecular formula C18H35NO5Si and a molecular weight of 373.6 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-[tert-butyl(dimethyl)silyl]oxypiperidine-1,3-dicarboxylate. InChIKey: MTNDGWYYLQBDLH-UHFFFAOYSA-N.
| Molecular formula | C18H35NO5Si |
|---|---|
| Molecular weight | 373.6 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-[tert-butyl(dimethyl)silyl]oxypiperidine-1,3-dicarboxylate |
| InChIKey | MTNDGWYYLQBDLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)O[Si](C)(C)C(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)