CAS 14158-66-8 appears in our catalog under these names: cis-Clomiphene Hydrochloride, >95% (HPLC), cis-Clomiphene hydrochloride. Offered by: TRC, HPC Standards. Available pack sizes: 10mg, 5mg, 1x5mg.
2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;hydrochloride (CAS 14158-66-8) is a chemical compound with the molecular formula C26H29Cl2NO and a molecular weight of 442.4 g/mol. IUPAC name: 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;hydrochloride. InChIKey: KKBZGZWPJGOGJF-OQKDUQJOSA-N.
| Molecular formula | C26H29Cl2NO |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;hydrochloride |
| InChIKey | KKBZGZWPJGOGJF-OQKDUQJOSA-N |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\Cl)/C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)