Products 1415800-45-1
CAS 1415800-45-1 is the registry number for tert-Butyl 3-(4,6-dichloropyrimidin-2-ylamino)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
Tert-butyl 3-[(4,6-dichloropyrimidin-2-yl)amino]pyrrolidine-1-carboxylate (CAS 1415800-45-1) is a chemical compound with the molecular formula C13H18Cl2N4O2 and a molecular weight of 333.21 g/mol. IUPAC name: tert-butyl 3-[(4,6-dichloropyrimidin-2-yl)amino]pyrrolidine-1-carboxylate. InChIKey: IDDOBSRWMQFECL-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N4O2 |
|---|---|
| Molecular weight | 333.21 g/mol |
| IUPAC name | tert-butyl 3-[(4,6-dichloropyrimidin-2-yl)amino]pyrrolidine-1-carboxylate |
| InChIKey | IDDOBSRWMQFECL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)NC2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)