Products 1415819-79-2

CAS 1415819-79-2 is the registry number for 2-(2-Phenoxyphenyl)piperidine oxalate (2:1), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Oxalic acid;bis(2-(2-phenoxyphenyl)piperidine) (CAS 1415819-79-2) is a chemical compound with the molecular formula C36H40N2O6 and a molecular weight of 596.7 g/mol. IUPAC name: oxalic acid;bis(2-(2-phenoxyphenyl)piperidine). InChIKey: WIILPIXMLKVIKP-UHFFFAOYSA-N.

Identity
Molecular formulaC36H40N2O6
Molecular weight596.7 g/mol
IUPAC nameoxalic acid;bis(2-(2-phenoxyphenyl)piperidine)
InChIKeyWIILPIXMLKVIKP-UHFFFAOYSA-N
SMILESC1CCNC(C1)C2=CC=CC=C2OC3=CC=CC=C3.C1CCNC(C1)C2=CC=CC=C2OC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)