CAS 1415844-67-5 appears in our catalog under these names: 4–Bromo–6–phenyldibenzo(b,d)thiophene, 4-Bromo-6-phenyldibenzo[b,d]thiophene, 95%, 95%, 4-BROMO-6-PHENYLDIBENZO[B,D]THIOPHENE, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-bromo-6-phenyldibenzothiophene (CAS 1415844-67-5) is a chemical compound with the molecular formula C18H11BrS and a molecular weight of 339.3 g/mol. IUPAC name: 4-bromo-6-phenyldibenzothiophene. InChIKey: LGGSHXHPRHARFY-UHFFFAOYSA-N.
| Molecular formula | C18H11BrS |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 4-bromo-6-phenyldibenzothiophene |
| InChIKey | LGGSHXHPRHARFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2SC4=C3C=CC=C4Br |
Computed by PubChem (NCBI)