CAS 14159-38-7 appears in our catalog under these names: 2-Chloropteridine, 95+%, 2-Chloropteridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloropteridine (CAS 14159-38-7) is a chemical compound with the molecular formula C6H3ClN4 and a molecular weight of 166.57 g/mol. IUPAC name: 2-chloropteridine. InChIKey: JISQBJRFTCXDEO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4 |
|---|---|
| Molecular weight | 166.57 g/mol |
| IUPAC name | 2-chloropteridine |
| InChIKey | JISQBJRFTCXDEO-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=NC(=N2)Cl |
Computed by PubChem (NCBI)