Products 14160-95-3
CAS 14160-95-3 appears in our catalog under these names: 4-Chloro-6-(dimethylamino)pyrimidine-5-carbaldehyde, 97%, 4-Chloro-6-(dimethylamino)pyrimidine-5-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
4-chloro-6-(dimethylamino)pyrimidine-5-carbaldehyde (CAS 14160-95-3) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 4-chloro-6-(dimethylamino)pyrimidine-5-carbaldehyde. InChIKey: RDLBBVSSNBKZOB-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 4-chloro-6-(dimethylamino)pyrimidine-5-carbaldehyde |
| InChIKey | RDLBBVSSNBKZOB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=NC=N1)Cl)C=O |
Computed by PubChem (NCBI)