CAS 1416134-48-9 appears in our catalog under these names: Avibactam Impurity 9, (2S,5R)-Ethyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate, 97%, (2S,5R)–Ethyl 5–((benzyloxy)amino)piperidine–2–carboxylate oxalate, (2S,5R)-Ethyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate 95%, (2S,5R)-Ethyl 5-((benzyloxy)amino)piperidine-2-carboxylate oxalate, 98%, 98%. Offered by: Chemat Brand, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 25g, 100g, 5g, 1g, 10g, 500g, 1kg.
Ethyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid (CAS 1416134-48-9) is a chemical compound with the molecular formula C17H24N2O7 and a molecular weight of 368.4 g/mol. IUPAC name: ethyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid. InChIKey: PYUXATUBICTSNB-DFQHDRSWSA-N.
| Molecular formula | C17H24N2O7 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | ethyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate;oxalic acid |
| InChIKey | PYUXATUBICTSNB-DFQHDRSWSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](CN1)NOCC2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)