CAS 1416330-84-1 appears in our catalog under these names: CAU–10(Al), Aluminum Hydroxide Isophthalate Mof (Cau-10, Isophthalate:Al=0.9-1.0). Offered by: GLPBio, Chemat. Available pack sizes: 2g, 500mg.
CAS 1416330-84-1 identifies a chemical compound with the molecular formula C8H6AlO5 and a molecular weight of 209.11 g/mol. InChIKey: FBRPJNGOMAZGBZ-UHFFFAOYSA-L.
| Molecular formula | C8H6AlO5 |
|---|---|
| Molecular weight | 209.11 g/mol |
| InChIKey | FBRPJNGOMAZGBZ-UHFFFAOYSA-L |
| SMILES | C1=CC2=CC(=C1)C(=O)O[Al]OC2=O.O |
Computed by PubChem (NCBI)