CAS 1416354-93-2 appears in our catalog under these names: (S)-2-Amino-1-(pyridin-3-yl)ethanol hydrochloride, 95%, (S)-2-Amino-1-(pyridin-3-yl)ethanol hydrochloride, 97%, (S)–2–Amino–1–(pyridin–3–yl)ethanol hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
(1S)-2-amino-1-pyridin-3-ylethanol;hydrochloride (CAS 1416354-93-2) is a chemical compound with the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. IUPAC name: (1S)-2-amino-1-pyridin-3-ylethanol;hydrochloride. InChIKey: PMVFSIPPTOOMTI-OGFXRTJISA-N.
| Molecular formula | C7H11ClN2O |
|---|---|
| Molecular weight | 174.63 g/mol |
| IUPAC name | (1S)-2-amino-1-pyridin-3-ylethanol;hydrochloride |
| InChIKey | PMVFSIPPTOOMTI-OGFXRTJISA-N |
| SMILES | C1=CC(=CN=C1)[C@@H](CN)O.Cl |
Computed by PubChem (NCBI)