CAS 1416432-55-7 is the registry number for ((1R,2S)-2-(Trifluoromethyl)cyclopropyl)methanol, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
[(1R,2S)-2-(trifluoromethyl)cyclopropyl]methanol (CAS 1416432-55-7) is a chemical compound with the molecular formula C5H7F3O and a molecular weight of 140.10 g/mol. IUPAC name: [(1R,2S)-2-(trifluoromethyl)cyclopropyl]methanol. InChIKey: YZAYHNYHJCPNAR-IMJSIDKUSA-N.
| Molecular formula | C5H7F3O |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | [(1R,2S)-2-(trifluoromethyl)cyclopropyl]methanol |
| InChIKey | YZAYHNYHJCPNAR-IMJSIDKUSA-N |
| SMILES | C1[C@H]([C@H]1C(F)(F)F)CO |
Computed by PubChem (NCBI)