CAS 1416708-67-2 is the registry number for 6,8-Di-tert-butyl-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-ditert-butylchromen-2-one (CAS 1416708-67-2) is a chemical compound with the molecular formula C17H22O2 and a molecular weight of 258.35 g/mol. IUPAC name: 6,8-ditert-butylchromen-2-one. InChIKey: OOGQCYXCKKNGMO-UHFFFAOYSA-N.
| Molecular formula | C17H22O2 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 6,8-ditert-butylchromen-2-one |
| InChIKey | OOGQCYXCKKNGMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C2C(=C1)C=CC(=O)O2)C(C)(C)C |
Computed by PubChem (NCBI)