CAS 1416711-54-0 appears in our catalog under these names: [(5-Fluoro-1h-indol-2-yl)methyl]amine methanesulfonate, 95%, ((5-Fluoro-1H-indol-2-yl)methyl)amine methanesulfonate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(5-fluoro-1H-indol-2-yl)methanamine;methanesulfonic acid (CAS 1416711-54-0) is a chemical compound with the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. IUPAC name: (5-fluoro-1H-indol-2-yl)methanamine;methanesulfonic acid. InChIKey: GLROZERRLXKJLN-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O3S |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (5-fluoro-1H-indol-2-yl)methanamine;methanesulfonic acid |
| InChIKey | GLROZERRLXKJLN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC2=C(C=C1F)C=C(N2)CN |
Computed by PubChem (NCBI)