Products 1416713-98-8
CAS 1416713-98-8 is the registry number for 5-tert-Butyl-2',3',5',6'-tetramethylbiphenyl-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-tert-butyl-2-(2,3,5,6-tetramethylphenyl)phenol (CAS 1416713-98-8) is a chemical compound with the molecular formula C20H26O and a molecular weight of 282.4 g/mol. IUPAC name: 4-tert-butyl-2-(2,3,5,6-tetramethylphenyl)phenol. InChIKey: KPKXORAIZLGJKR-UHFFFAOYSA-N.
| Molecular formula | C20H26O |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-tert-butyl-2-(2,3,5,6-tetramethylphenyl)phenol |
| InChIKey | KPKXORAIZLGJKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)C2=C(C=CC(=C2)C(C)(C)C)O)C)C |
Computed by PubChem (NCBI)