CAS 1416851-16-5 is the registry number for 4–(n–Propyl)thiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
4,4,5,5-tetramethyl-2-(4-propylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 1416851-16-5) is a chemical compound with the molecular formula C13H21BO2S and a molecular weight of 252.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: ORJAWVITXDATLH-UHFFFAOYSA-N.
| Molecular formula | C13H21BO2S |
|---|---|
| Molecular weight | 252.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | ORJAWVITXDATLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)CCC |
Computed by PubChem (NCBI)