CAS 1416943-27-5 appears in our catalog under these names: NPEC-caged-D-AP5, NPEC–caged–D–AP5. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg, 50mg.
(2R)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]-5-phosphonopentanoic acid (CAS 1416943-27-5) is a chemical compound with the molecular formula C14H19N2O9P and a molecular weight of 390.28 g/mol. IUPAC name: (2R)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]-5-phosphonopentanoic acid. InChIKey: RLEANJAZNZWLHC-HCCKASOXSA-N.
| Molecular formula | C14H19N2O9P |
|---|---|
| Molecular weight | 390.28 g/mol |
| IUPAC name | (2R)-2-[1-(2-nitrophenyl)ethoxycarbonylamino]-5-phosphonopentanoic acid |
| InChIKey | RLEANJAZNZWLHC-HCCKASOXSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])OC(=O)N[C@H](CCCP(=O)(O)O)C(=O)O |
Computed by PubChem (NCBI)