Products 141703-10-8

CAS 141703-10-8 is the registry number for 1,5-Bis((4-methoxybenzyl)oxy)-4-oxo-1,4-dihydropyridine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,5-bis[(4-methoxyphenyl)methoxy]-4-oxopyridine-2-carboxylic acid (CAS 141703-10-8) is a chemical compound with the molecular formula C22H21NO7 and a molecular weight of 411.4 g/mol. IUPAC name: 1,5-bis[(4-methoxyphenyl)methoxy]-4-oxopyridine-2-carboxylic acid. InChIKey: NJSKXZXYOOZUOH-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21NO7
Molecular weight411.4 g/mol
IUPAC name1,5-bis[(4-methoxyphenyl)methoxy]-4-oxopyridine-2-carboxylic acid
InChIKeyNJSKXZXYOOZUOH-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC2=CN(C(=CC2=O)C(=O)O)OCC3=CC=C(C=C3)OC

Computed by PubChem (NCBI)