CAS 1417200-36-2 appears in our catalog under these names: 2-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 95%, 4-Bromo-3-formylphenylboronic acid pinacol ester, ≥95%, ≥95%, 4-Bromo-3-formylphenylboronic acid pinacol ester. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1417200-36-2) is a chemical compound with the molecular formula C13H16BBrO3 and a molecular weight of 310.98 g/mol. IUPAC name: 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: GHLAMZGDVNZKEY-UHFFFAOYSA-N.
| Molecular formula | C13H16BBrO3 |
|---|---|
| Molecular weight | 310.98 g/mol |
| IUPAC name | 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | GHLAMZGDVNZKEY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)