CAS 1417316-64-3 is the registry number for (E)-N,N-Diphenyl-4-(4-(triphenylen-2-yl)styryl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-diphenyl-4-[(E)-2-(4-triphenylen-2-ylphenyl)ethenyl]aniline (CAS 1417316-64-3) is a chemical compound with the molecular formula C44H31N and a molecular weight of 573.7 g/mol. IUPAC name: N,N-diphenyl-4-[(E)-2-(4-triphenylen-2-ylphenyl)ethenyl]aniline. InChIKey: NZGAKYAQARWTLT-FMQUCBEESA-N.
| Molecular formula | C44H31N |
|---|---|
| Molecular weight | 573.7 g/mol |
| IUPAC name | N,N-diphenyl-4-[(E)-2-(4-triphenylen-2-ylphenyl)ethenyl]aniline |
| InChIKey | NZGAKYAQARWTLT-FMQUCBEESA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)/C=C/C4=CC=C(C=C4)C5=CC6=C(C=C5)C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)